C7H6N2OS2 — CID 15035747
2-methylsulfinyl-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 15035747) has the molecular formula C7H6N2OS2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 2-methylsulfinyl-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 2-methylsulfinyl-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 15035747 |
| Molecular Formula | C7H6N2OS2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.99 |
| IUPAC Name | 2-methylsulfinyl-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | CS(=O)c1nc2cccnc2s1 |
| InChI | InChI=1S/C7H6N2OS2/c1-12(10)7-9-5-3-2-4-8-6(5)11-7/h2-4H,1H3 |
| InChIKey | GRDKVKRPSCUXJS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |