About CID 177336385
CID 177336385 (PubChem CID 177336385) has the molecular formula C8H7BN2S
and a molecular weight of 174.04 g/mol.
Molecular Properties
| Compound Name | CID 177336385 |
| PubChem CID | 177336385 |
| Molecular Formula | C8H7BN2S |
| Molecular Weight | 174.04 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | — |
| SMILES | [B]C(C)c1nc2cccnc2s1 |
| InChI | InChI=1S/C8H7BN2S/c1-5(9)7-11-6-3-2-4-10-8(6)12-7/h2-5H,1H3 |
| InChIKey | MFTZBYUUUQUYAH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.04 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177336385 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177336385?
The IUPAC name of CID 177336385 (CID 177336385) is not available.
What is the SMILES notation for CID 177336385?
The canonical SMILES for CID 177336385 is [B]C(C)c1nc2cccnc2s1.
What is the InChIKey of CID 177336385?
The InChIKey is MFTZBYUUUQUYAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BN2S/c1-5(9)7-11-6-3-2-4-10-8(6)12-7/h2-5H,1H3.
What are the key properties of CID 177336385?
CID 177336385 has a molecular weight of 174.04 g/mol, XLogP of 1.92, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177336385 is sourced from PubChem (CID 177336385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).