C12H9N3OS — CID 136872164
2-amino-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenol (PubChem CID 136872164) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-amino-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenol.
| Compound Name | 2-amino-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenol |
|---|---|
| PubChem CID | 136872164 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-amino-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenol |
| SMILES | Nc1cc(-c2nc3cccnc3s2)ccc1O |
| InChI | InChI=1S/C12H9N3OS/c13-8-6-7(3-4-10(8)16)11-15-9-2-1-5-14-12(9)17-11/h1-6,16H,13H2 |
| InChIKey | UIROBCCPQKHNTL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|