C16H13FN2O2S — CID 173352136
2-[3-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]anilino]acetaldehyde (PubChem CID 173352136) has the molecular formula C16H13FN2O2S and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-[3-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]anilino]acetaldehyde.
| Compound Name | 2-[3-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]anilino]acetaldehyde |
|---|---|
| PubChem CID | 173352136 |
| Molecular Formula | C16H13FN2O2S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-[3-[(5-fluoro-1,3-benzothiazol-2-yl)methoxy]anilino]acetaldehyde |
| SMILES | O=CCNc1cccc(OCc2nc3cc(F)ccc3s2)c1 |
| InChI | InChI=1S/C16H13FN2O2S/c17-11-4-5-15-14(8-11)19-16(22-15)10-21-13-3-1-2-12(9-13)18-6-7-20/h1-5,7-9,18H,6,10H2 |
| InChIKey | NVLVDJFDWJRTHK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|