C17H13FN2OS — CID 173352134
2-[3-[2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]anilino]acetaldehyde (PubChem CID 173352134) has the molecular formula C17H13FN2OS and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[3-[2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]anilino]acetaldehyde.
| Compound Name | 2-[3-[2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]anilino]acetaldehyde |
|---|---|
| PubChem CID | 173352134 |
| Molecular Formula | C17H13FN2OS |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-[3-[2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]anilino]acetaldehyde |
| SMILES | O=CCNc1cccc(C=Cc2nc3cc(F)ccc3s2)c1 |
| InChI | InChI=1S/C17H13FN2OS/c18-13-5-6-16-15(11-13)20-17(22-16)7-4-12-2-1-3-14(10-12)19-8-9-21/h1-7,9-11,19H,8H2 |
| InChIKey | QNVKATBMQAEJSG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|