C15H11FN2S — CID 54173344
3-[2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]aniline (PubChem CID 54173344) has the molecular formula C15H11FN2S and a molecular weight of 270.33 g/mol. Its IUPAC name is 3-[2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]aniline.
| Compound Name | 3-[2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 54173344 |
| Molecular Formula | C15H11FN2S |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 3-[2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]aniline |
| SMILES | Nc1cccc(C=Cc2nc3cc(F)ccc3s2)c1 |
| InChI | InChI=1S/C15H11FN2S/c16-11-5-6-14-13(9-11)18-15(19-14)7-4-10-2-1-3-12(17)8-10/h1-9H,17H2 |
| InChIKey | OWOAXSNHLMVMAM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|