C16H10FNOS — CID 86747932
3-[(E)-2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]benzaldehyde (PubChem CID 86747932) has the molecular formula C16H10FNOS and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-[(E)-2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]benzaldehyde.
| Compound Name | 3-[(E)-2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]benzaldehyde |
|---|---|
| PubChem CID | 86747932 |
| Molecular Formula | C16H10FNOS |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 3-[(E)-2-(5-fluoro-1,3-benzothiazol-2-yl)ethenyl]benzaldehyde |
| SMILES | O=Cc1cccc(/C=C/c2nc3cc(F)ccc3s2)c1 |
| InChI | InChI=1S/C16H10FNOS/c17-13-5-6-15-14(9-13)18-16(20-15)7-4-11-2-1-3-12(8-11)10-19/h1-10H/b7-4+ |
| InChIKey | BKAJXRPFSJRBME-QPJJXVBHSA-N |
| XLogP | 4.42 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|