C16H14N4O2S2 — CID 40579547
(1S,2S)-1,2-bis(6-amino-1,3-benzothiazol-2-yl)ethane-1,2-diol (PubChem CID 40579547) has the molecular formula C16H14N4O2S2 and a molecular weight of 358.45 g/mol. Its IUPAC name is (1S,2S)-1,2-bis(6-amino-1,3-benzothiazol-2-yl)ethane-1,2-diol.
| Compound Name | (1S,2S)-1,2-bis(6-amino-1,3-benzothiazol-2-yl)ethane-1,2-diol |
|---|---|
| PubChem CID | 40579547 |
| Molecular Formula | C16H14N4O2S2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | (1S,2S)-1,2-bis(6-amino-1,3-benzothiazol-2-yl)ethane-1,2-diol |
| SMILES | Nc1ccc2nc([C@@H](O)[C@H](O)c3nc4ccc(N)cc4s3)sc2c1 |
| InChI | InChI=1S/C16H14N4O2S2/c17-7-1-3-9-11(5-7)23-15(19-9)13(21)14(22)16-20-10-4-2-8(18)6-12(10)24-16/h1-6,13-14,21-22H,17-18H2/t13-,14-/m0/s1 |
| InChIKey | YDSXKXMLRPERJQ-KBPBESRZSA-N |
| XLogP | 2.84 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|