C15H14N2O2S2 — CID 61367237
2-[(4-methylphenyl)methylsulfonyl]-1,3-benzothiazol-6-amine (PubChem CID 61367237) has the molecular formula C15H14N2O2S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methylsulfonyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-[(4-methylphenyl)methylsulfonyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 61367237 |
| Molecular Formula | C15H14N2O2S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[(4-methylphenyl)methylsulfonyl]-1,3-benzothiazol-6-amine |
| SMILES | Cc1ccc(CS(=O)(=O)c2nc3ccc(N)cc3s2)cc1 |
| InChI | InChI=1S/C15H14N2O2S2/c1-10-2-4-11(5-3-10)9-21(18,19)15-17-13-7-6-12(16)8-14(13)20-15/h2-8H,9,16H2,1H3 |
| InChIKey | UFMJCMRTMBDKBE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|