C12H12N4O2S2 — CID 61494708
2-(2-pyrazol-1-ylethylsulfonyl)-1,3-benzothiazol-6-amine (PubChem CID 61494708) has the molecular formula C12H12N4O2S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-(2-pyrazol-1-ylethylsulfonyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(2-pyrazol-1-ylethylsulfonyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 61494708 |
| Molecular Formula | C12H12N4O2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-(2-pyrazol-1-ylethylsulfonyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)(=O)CCn3cccn3)sc2c1 |
| InChI | InChI=1S/C12H12N4O2S2/c13-9-2-3-10-11(8-9)19-12(15-10)20(17,18)7-6-16-5-1-4-14-16/h1-5,8H,6-7,13H2 |
| InChIKey | HOBIMYSHKPHXDZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|