C12H16N2O3S2 — CID 65180674
2-(3-ethoxypropylsulfonyl)-1,3-benzothiazol-6-amine (PubChem CID 65180674) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 2-(3-ethoxypropylsulfonyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(3-ethoxypropylsulfonyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 65180674 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-(3-ethoxypropylsulfonyl)-1,3-benzothiazol-6-amine |
| SMILES | CCOCCCS(=O)(=O)c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-2-17-6-3-7-19(15,16)12-14-10-5-4-9(13)8-11(10)18-12/h4-5,8H,2-3,6-7,13H2,1H3 |
| InChIKey | SCULATAJYDWYHP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|