C13H16N2O3S2 — CID 61368196
2-(oxan-2-ylmethylsulfonyl)-1,3-benzothiazol-6-amine (PubChem CID 61368196) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-(oxan-2-ylmethylsulfonyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(oxan-2-ylmethylsulfonyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 61368196 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-(oxan-2-ylmethylsulfonyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)(=O)CC3CCCCO3)sc2c1 |
| InChI | InChI=1S/C13H16N2O3S2/c14-9-4-5-11-12(7-9)19-13(15-11)20(16,17)8-10-3-1-2-6-18-10/h4-5,7,10H,1-3,6,8,14H2 |
| InChIKey | BWQAEODKTBQMPJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|