C12H14N2O3S2 — CID 55090459
2-(oxolan-2-ylmethylsulfonyl)-1,3-benzothiazol-6-amine (PubChem CID 55090459) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfonyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(oxolan-2-ylmethylsulfonyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 55090459 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfonyl)-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)(=O)CC3CCCO3)sc2c1 |
| InChI | InChI=1S/C12H14N2O3S2/c13-8-3-4-10-11(6-8)18-12(14-10)19(15,16)7-9-2-1-5-17-9/h3-4,6,9H,1-2,5,7,13H2 |
| InChIKey | RPYZTXUGJYGTGI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|