C11H14N2O2S2 — CID 61367872
2-(2-ethoxyethylsulfinyl)-1,3-benzothiazol-6-amine (PubChem CID 61367872) has the molecular formula C11H14N2O2S2 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-(2-ethoxyethylsulfinyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(2-ethoxyethylsulfinyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 61367872 |
| Molecular Formula | C11H14N2O2S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | 2-(2-ethoxyethylsulfinyl)-1,3-benzothiazol-6-amine |
| SMILES | CCOCCS(=O)c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C11H14N2O2S2/c1-2-15-5-6-17(14)11-13-9-4-3-8(12)7-10(9)16-11/h3-4,7H,2,5-6,12H2,1H3 |
| InChIKey | FVHIJTGVKXNBOD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|