C13H17NO3S2 — CID 19094200
6-ethoxy-2-(2-ethoxyethylsulfinyl)-1,3-benzothiazole (PubChem CID 19094200) has the molecular formula C13H17NO3S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 6-ethoxy-2-(2-ethoxyethylsulfinyl)-1,3-benzothiazole.
| Compound Name | 6-ethoxy-2-(2-ethoxyethylsulfinyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 19094200 |
| Molecular Formula | C13H17NO3S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 6-ethoxy-2-(2-ethoxyethylsulfinyl)-1,3-benzothiazole |
| SMILES | CCOCCS(=O)c1nc2ccc(OCC)cc2s1 |
| InChI | InChI=1S/C13H17NO3S2/c1-3-16-7-8-19(15)13-14-11-6-5-10(17-4-2)9-12(11)18-13/h5-6,9H,3-4,7-8H2,1-2H3 |
| InChIKey | PGYYPVAVFNHEDL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|