C14H21NO5S2 — CID 157280824
diethyl sulfate;6-ethoxy-2-methyl-1,3-benzothiazole (PubChem CID 157280824) has the molecular formula C14H21NO5S2 and a molecular weight of 347.46 g/mol. Its IUPAC name is diethyl sulfate;6-ethoxy-2-methyl-1,3-benzothiazole.
| Compound Name | diethyl sulfate;6-ethoxy-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 157280824 |
| Molecular Formula | C14H21NO5S2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | diethyl sulfate;6-ethoxy-2-methyl-1,3-benzothiazole |
| SMILES | CCOS(=O)(=O)OCC.CCOc1ccc2nc(C)sc2c1 |
| InChI | InChI=1S/C10H11NOS.C4H10O4S/c1-3-12-8-4-5-9-10(6-8)13-7(2)11-9;1-3-7-9(5,6)8-4-2/h4-6H,3H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | AZQKRQGVQGYWCU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |