C16H11N2NaO5S3 — CID 118723898
sodium [2-[(2-methyl-1,3-benzothiazol-6-yl)oxymethyl]-1,3-benzothiazol-6-yl] sulfate (PubChem CID 118723898) has the molecular formula C16H11N2NaO5S3 and a molecular weight of 430.46 g/mol. Its IUPAC name is sodium [2-[(2-methyl-1,3-benzothiazol-6-yl)oxymethyl]-1,3-benzothiazol-6-yl] sulfate.
| Compound Name | sodium [2-[(2-methyl-1,3-benzothiazol-6-yl)oxymethyl]-1,3-benzothiazol-6-yl] sulfate |
|---|---|
| PubChem CID | 118723898 |
| Molecular Formula | C16H11N2NaO5S3 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 429.97 |
| IUPAC Name | sodium [2-[(2-methyl-1,3-benzothiazol-6-yl)oxymethyl]-1,3-benzothiazol-6-yl] sulfate |
| SMILES | Cc1nc2ccc(OCc3nc4ccc(OS(=O)(=O)[O-])cc4s3)cc2s1.[Na+] |
| InChI | InChI=1S/C16H12N2O5S3.Na/c1-9-17-12-4-2-10(6-14(12)24-9)22-8-16-18-13-5-3-11(7-15(13)25-16)23-26(19,20)21;/h2-7H,8H2,1H3,(H,19,20,21);/q;+1/p-1 |
| InChIKey | DDOWAHWKGONYQO-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 101.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|