C27H22NNaO9S2 — CID 118723896
sodium [2-[(2-benzyl-3-ethoxycarbonyl-6-methoxy-1-benzofuran-5-yl)oxymethyl]-1,3-benzothiazol-6-yl] sulfate (PubChem CID 118723896) has the molecular formula C27H22NNaO9S2 and a molecular weight of 591.60 g/mol. Its IUPAC name is sodium [2-[(2-benzyl-3-ethoxycarbonyl-6-methoxy-1-benzofuran-5-yl)oxymethyl]-1,3-benzothiazol-6-yl] sulfate.
| Compound Name | sodium [2-[(2-benzyl-3-ethoxycarbonyl-6-methoxy-1-benzofuran-5-yl)oxymethyl]-1,3-benzothiazol-6-yl] sulfate |
|---|---|
| PubChem CID | 118723896 |
| Molecular Formula | C27H22NNaO9S2 |
| Molecular Weight | 591.60 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | sodium [2-[(2-benzyl-3-ethoxycarbonyl-6-methoxy-1-benzofuran-5-yl)oxymethyl]-1,3-benzothiazol-6-yl] sulfate |
| SMILES | CCOC(=O)c1c(Cc2ccccc2)oc2cc(OC)c(OCc3nc4ccc(OS(=O)(=O)[O-])cc4s3)cc12.[Na+] |
| InChI | InChI=1S/C27H23NO9S2.Na/c1-3-34-27(29)26-18-13-22(21(33-2)14-20(18)36-23(26)11-16-7-5-4-6-8-16)35-15-25-28-19-10-9-17(12-24(19)38-25)37-39(30,31)32;/h4-10,12-14H,3,11,15H2,1-2H3,(H,30,31,32);/q;+1/p-1 |
| InChIKey | OOULSPNCYLAOMU-UHFFFAOYSA-M |
| XLogP | 2.24 |
| TPSA | 137.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|