C14H19NO9S — CID 53392346
azanium [6-methoxy-3-(2-methoxyethoxycarbonyl)-2-methyl-1-benzofuran-5-yl] sulfate (PubChem CID 53392346) has the molecular formula C14H19NO9S and a molecular weight of 377.37 g/mol. Its IUPAC name is azanium [6-methoxy-3-(2-methoxyethoxycarbonyl)-2-methyl-1-benzofuran-5-yl] sulfate.
| Compound Name | azanium [6-methoxy-3-(2-methoxyethoxycarbonyl)-2-methyl-1-benzofuran-5-yl] sulfate |
|---|---|
| PubChem CID | 53392346 |
| Molecular Formula | C14H19NO9S |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | azanium [6-methoxy-3-(2-methoxyethoxycarbonyl)-2-methyl-1-benzofuran-5-yl] sulfate |
| SMILES | COCCOC(=O)c1c(C)oc2cc(OC)c(OS(=O)(=O)[O-])cc12.[NH4+] |
| InChI | InChI=1S/C14H16O9S.H3N/c1-8-13(14(15)21-5-4-19-2)9-6-12(23-24(16,17)18)11(20-3)7-10(9)22-8;/h6-7H,4-5H2,1-3H3,(H,16,17,18);1H3 |
| InChIKey | IURGUQZHJYQJFI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 160.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|