C18H20O7 — CID 152610053
diethyl 1-hydroxy-6,7-dimethoxynaphthalene-2,3-dicarboxylate (PubChem CID 152610053) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is diethyl 1-hydroxy-6,7-dimethoxynaphthalene-2,3-dicarboxylate.
| Compound Name | diethyl 1-hydroxy-6,7-dimethoxynaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 152610053 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | diethyl 1-hydroxy-6,7-dimethoxynaphthalene-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc2cc(OC)c(OC)cc2c(O)c1C(=O)OCC |
| InChI | InChI=1S/C18H20O7/c1-5-24-17(20)12-7-10-8-13(22-3)14(23-4)9-11(10)16(19)15(12)18(21)25-6-2/h7-9,19H,5-6H2,1-4H3 |
| InChIKey | YZIAHPMBKZYYBX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |