C16H15FO5 — CID 143526061
diethyl 6-fluoro-1-hydroxynaphthalene-2,3-dicarboxylate (PubChem CID 143526061) has the molecular formula C16H15FO5 and a molecular weight of 306.29 g/mol. Its IUPAC name is diethyl 6-fluoro-1-hydroxynaphthalene-2,3-dicarboxylate.
| Compound Name | diethyl 6-fluoro-1-hydroxynaphthalene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 143526061 |
| Molecular Formula | C16H15FO5 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | diethyl 6-fluoro-1-hydroxynaphthalene-2,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc2cc(F)ccc2c(O)c1C(=O)OCC |
| InChI | InChI=1S/C16H15FO5/c1-3-21-15(19)12-8-9-7-10(17)5-6-11(9)14(18)13(12)16(20)22-4-2/h5-8,18H,3-4H2,1-2H3 |
| InChIKey | KRJYIWFEUBJJSC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |