C12H15NOS — CID 58125430
2-methyl-6-(2-methylpropoxy)-1,3-benzothiazole (PubChem CID 58125430) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 2-methyl-6-(2-methylpropoxy)-1,3-benzothiazole.
| Compound Name | 2-methyl-6-(2-methylpropoxy)-1,3-benzothiazole |
|---|---|
| PubChem CID | 58125430 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 2-methyl-6-(2-methylpropoxy)-1,3-benzothiazole |
| SMILES | Cc1nc2ccc(OCC(C)C)cc2s1 |
| InChI | InChI=1S/C12H15NOS/c1-8(2)7-14-10-4-5-11-12(6-10)15-9(3)13-11/h4-6,8H,7H2,1-3H3 |
| InChIKey | KGAMZSKWZUHIDK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |