C15H21N3OS — CID 82191912
1-[6-(2-methylpropoxy)-1,3-benzothiazol-2-yl]pyrrolidin-3-amine (PubChem CID 82191912) has the molecular formula C15H21N3OS and a molecular weight of 291.42 g/mol. Its IUPAC name is 1-[6-(2-methylpropoxy)-1,3-benzothiazol-2-yl]pyrrolidin-3-amine.
| Compound Name | 1-[6-(2-methylpropoxy)-1,3-benzothiazol-2-yl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 82191912 |
| Molecular Formula | C15H21N3OS |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 1-[6-(2-methylpropoxy)-1,3-benzothiazol-2-yl]pyrrolidin-3-amine |
| SMILES | CC(C)COc1ccc2nc(N3CCC(N)C3)sc2c1 |
| InChI | InChI=1S/C15H21N3OS/c1-10(2)9-19-12-3-4-13-14(7-12)20-15(17-13)18-6-5-11(16)8-18/h3-4,7,10-11H,5-6,8-9,16H2,1-2H3 |
| InChIKey | BWQQWBRYGXUVHZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |