C12H14N2OS2 — CID 142660167
1-(6-ethoxy-1,3-benzothiazol-2-yl)azetidine-3-thiol (PubChem CID 142660167) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 1-(6-ethoxy-1,3-benzothiazol-2-yl)azetidine-3-thiol.
| Compound Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)azetidine-3-thiol |
|---|---|
| PubChem CID | 142660167 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)azetidine-3-thiol |
| SMILES | CCOc1ccc2nc(N3CC(S)C3)sc2c1 |
| InChI | InChI=1S/C12H14N2OS2/c1-2-15-8-3-4-10-11(5-8)17-12(13-10)14-6-9(16)7-14/h3-5,9,16H,2,6-7H2,1H3 |
| InChIKey | KICBRCFRHPFJET-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 25.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|