C14H13N2O4S- — CID 9003928
(3R)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9003928) has the molecular formula C14H13N2O4S- and a molecular weight of 305.34 g/mol. Its IUPAC name is (3R)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (3R)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9003928 |
| Molecular Formula | C14H13N2O4S- |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | (3R)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1ccc2nc(N3C[C@H](C(=O)[O-])CC3=O)sc2c1 |
| InChI | InChI=1S/C14H14N2O4S/c1-2-20-9-3-4-10-11(6-9)21-14(15-10)16-7-8(13(18)19)5-12(16)17/h3-4,6,8H,2,5,7H2,1H3,(H,18,19)/p-1/t8-/m1/s1 |
| InChIKey | LAPDESDHGIPRKI-MRVPVSSYSA-M |
| XLogP | 0.80 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |