C20H27N3O3S — CID 154820044
1-(6-ethoxy-1,3-benzothiazol-2-yl)-N-methyl-5-oxo-N-pentylpyrrolidine-3-carboxamide (PubChem CID 154820044) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-(6-ethoxy-1,3-benzothiazol-2-yl)-N-methyl-5-oxo-N-pentylpyrrolidine-3-carboxamide.
| Compound Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-N-methyl-5-oxo-N-pentylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 154820044 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-(6-ethoxy-1,3-benzothiazol-2-yl)-N-methyl-5-oxo-N-pentylpyrrolidine-3-carboxamide |
| SMILES | CCCCCN(C)C(=O)C1CC(=O)N(c2nc3ccc(OCC)cc3s2)C1 |
| InChI | InChI=1S/C20H27N3O3S/c1-4-6-7-10-22(3)19(25)14-11-18(24)23(13-14)20-21-16-9-8-15(26-5-2)12-17(16)27-20/h8-9,12,14H,4-7,10-11,13H2,1-3H3 |
| InChIKey | LKLFZFVUNMOURK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|