C21H19N3O6S — CID 2983175
(4-nitrophenyl)methyl 1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 2983175) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 2983175 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | (4-nitrophenyl)methyl 1-(6-ethoxy-1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCOc1ccc2nc(N3CC(C(=O)OCc4ccc([N+](=O)[O-])cc4)CC3=O)sc2c1 |
| InChI | InChI=1S/C21H19N3O6S/c1-2-29-16-7-8-17-18(10-16)31-21(22-17)23-11-14(9-19(23)25)20(26)30-12-13-3-5-15(6-4-13)24(27)28/h3-8,10,14H,2,9,11-12H2,1H3 |
| InChIKey | VOGRPUXBZBTKRQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|