C22H19N3O6S — CID 41132998
(4-nitrophenyl)methyl (3S)-1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 41132998) has the molecular formula C22H19N3O6S and a molecular weight of 453.48 g/mol. Its IUPAC name is (4-nitrophenyl)methyl (3S)-1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-nitrophenyl)methyl (3S)-1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 41132998 |
| Molecular Formula | C22H19N3O6S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | (4-nitrophenyl)methyl (3S)-1-[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | COc1cccc(-c2csc(N3C[C@@H](C(=O)OCc4ccc([N+](=O)[O-])cc4)CC3=O)n2)c1 |
| InChI | InChI=1S/C22H19N3O6S/c1-30-18-4-2-3-15(9-18)19-13-32-22(23-19)24-11-16(10-20(24)26)21(27)31-12-14-5-7-17(8-6-14)25(28)29/h2-9,13,16H,10-12H2,1H3/t16-/m0/s1 |
| InChIKey | GNWIPBDZSVHYQF-INIZCTEOSA-N |
| XLogP | 3.82 |
| TPSA | 111.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|