C23H19N3O6S — CID 3843907
[2-(4-nitrophenyl)-2-oxoethyl] 1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxylate (PubChem CID 3843907) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is [2-(4-nitrophenyl)-2-oxoethyl] 1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-nitrophenyl)-2-oxoethyl] 1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 3843907 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | [2-(4-nitrophenyl)-2-oxoethyl] 1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(-c2csc(N3CC(C(=O)OCC(=O)c4ccc([N+](=O)[O-])cc4)CC3=O)n2)cc1 |
| InChI | InChI=1S/C23H19N3O6S/c1-14-2-4-15(5-3-14)19-13-33-23(24-19)25-11-17(10-21(25)28)22(29)32-12-20(27)16-6-8-18(9-7-16)26(30)31/h2-9,13,17H,10-12H2,1H3 |
| InChIKey | LTLIJUBYPFCADJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 119.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|