C12H12N2O3S — CID 11837258
3-(6-ethoxy-1,3-benzothiazol-2-yl)-1,3-oxazolidin-2-one (PubChem CID 11837258) has the molecular formula C12H12N2O3S and a molecular weight of 264.31 g/mol. Its IUPAC name is 3-(6-ethoxy-1,3-benzothiazol-2-yl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(6-ethoxy-1,3-benzothiazol-2-yl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11837258 |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 3-(6-ethoxy-1,3-benzothiazol-2-yl)-1,3-oxazolidin-2-one |
| SMILES | CCOc1ccc2nc(N3CCOC3=O)sc2c1 |
| InChI | InChI=1S/C12H12N2O3S/c1-2-16-8-3-4-9-10(7-8)18-11(13-9)14-5-6-17-12(14)15/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | UGYDKNXCZWRUHB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |