C10H11NO2S2 — CID 119089586
6-ethoxy-2-methylsulfinyl-1,3-benzothiazole (PubChem CID 119089586) has the molecular formula C10H11NO2S2 and a molecular weight of 241.34 g/mol. Its IUPAC name is 6-ethoxy-2-methylsulfinyl-1,3-benzothiazole.
| Compound Name | 6-ethoxy-2-methylsulfinyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 119089586 |
| Molecular Formula | C10H11NO2S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 6-ethoxy-2-methylsulfinyl-1,3-benzothiazole |
| SMILES | CCOc1ccc2nc(S(C)=O)sc2c1 |
| InChI | InChI=1S/C10H11NO2S2/c1-3-13-7-4-5-8-9(6-7)14-10(11-8)15(2)12/h4-6H,3H2,1-2H3 |
| InChIKey | RRHSSPJAKMIKOD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |