C11H14N2O2S — CID 79518172
2-amino-1-(6-ethoxy-1,3-benzothiazol-2-yl)ethanol (PubChem CID 79518172) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-amino-1-(6-ethoxy-1,3-benzothiazol-2-yl)ethanol.
| Compound Name | 2-amino-1-(6-ethoxy-1,3-benzothiazol-2-yl)ethanol |
|---|---|
| PubChem CID | 79518172 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-amino-1-(6-ethoxy-1,3-benzothiazol-2-yl)ethanol |
| SMILES | CCOc1ccc2nc(C(O)CN)sc2c1 |
| InChI | InChI=1S/C11H14N2O2S/c1-2-15-7-3-4-8-10(5-7)16-11(13-8)9(14)6-12/h3-5,9,14H,2,6,12H2,1H3 |
| InChIKey | KKZCMQGEOIEJDM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |