C14H20N2OS — CID 79873288
N-[1-(6-ethoxy-1,3-benzothiazol-2-yl)ethyl]propan-1-amine (PubChem CID 79873288) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is N-[1-(6-ethoxy-1,3-benzothiazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(6-ethoxy-1,3-benzothiazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79873288 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-[1-(6-ethoxy-1,3-benzothiazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1nc2ccc(OCC)cc2s1 |
| InChI | InChI=1S/C14H20N2OS/c1-4-8-15-10(3)14-16-12-7-6-11(17-5-2)9-13(12)18-14/h6-7,9-10,15H,4-5,8H2,1-3H3 |
| InChIKey | JRFIJSGURDAUAB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |