C13H18N2S — CID 79872914
N-[1-(6-methyl-1,3-benzothiazol-2-yl)ethyl]propan-1-amine (PubChem CID 79872914) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is N-[1-(6-methyl-1,3-benzothiazol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(6-methyl-1,3-benzothiazol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79872914 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-[1-(6-methyl-1,3-benzothiazol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1nc2ccc(C)cc2s1 |
| InChI | InChI=1S/C13H18N2S/c1-4-7-14-10(3)13-15-11-6-5-9(2)8-12(11)16-13/h5-6,8,10,14H,4,7H2,1-3H3 |
| InChIKey | ZXCWSPJMTVCGGC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |