C15H12ClNS — CID 79142998
2-[chloro(phenyl)methyl]-6-methyl-1,3-benzothiazole (PubChem CID 79142998) has the molecular formula C15H12ClNS and a molecular weight of 273.79 g/mol. Its IUPAC name is 2-[chloro(phenyl)methyl]-6-methyl-1,3-benzothiazole.
| Compound Name | 2-[chloro(phenyl)methyl]-6-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 79142998 |
| Molecular Formula | C15H12ClNS |
| Molecular Weight | 273.79 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-[chloro(phenyl)methyl]-6-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(C(Cl)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C15H12ClNS/c1-10-7-8-12-13(9-10)18-15(17-12)14(16)11-5-3-2-4-6-11/h2-9,14H,1H3 |
| InChIKey | TYUQSNSTDICDLC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|