C14H11NOS — CID 44549864
6-methyl-2-phenoxy-1,3-benzothiazole (PubChem CID 44549864) has the molecular formula C14H11NOS and a molecular weight of 241.31 g/mol. Its IUPAC name is 6-methyl-2-phenoxy-1,3-benzothiazole.
| Compound Name | 6-methyl-2-phenoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 44549864 |
| Molecular Formula | C14H11NOS |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | 6-methyl-2-phenoxy-1,3-benzothiazole |
| SMILES | Cc1ccc2nc(Oc3ccccc3)sc2c1 |
| InChI | InChI=1S/C14H11NOS/c1-10-7-8-12-13(9-10)17-14(15-12)16-11-5-3-2-4-6-11/h2-9H,1H3 |
| InChIKey | REKYKROSKVNCLP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |