C21H16N4O2S — CID 91178930
6-(1-azidoethyl)-2-(4-phenoxyphenoxy)-1,3-benzothiazole (PubChem CID 91178930) has the molecular formula C21H16N4O2S and a molecular weight of 388.45 g/mol. Its IUPAC name is 6-(1-azidoethyl)-2-(4-phenoxyphenoxy)-1,3-benzothiazole.
| Compound Name | 6-(1-azidoethyl)-2-(4-phenoxyphenoxy)-1,3-benzothiazole |
|---|---|
| PubChem CID | 91178930 |
| Molecular Formula | C21H16N4O2S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 6-(1-azidoethyl)-2-(4-phenoxyphenoxy)-1,3-benzothiazole |
| SMILES | CC(N=[N+]=[N-])c1ccc2nc(Oc3ccc(Oc4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C21H16N4O2S/c1-14(24-25-22)15-7-12-19-20(13-15)28-21(23-19)27-18-10-8-17(9-11-18)26-16-5-3-2-4-6-16/h2-14H,1H3 |
| InChIKey | CIPPOXBTWQGHOL-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 80.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|