C13H18N2O2S2 — CID 106455863
2-[2-(2-methylpropoxy)ethylsulfinyl]-1,3-benzothiazol-6-amine (PubChem CID 106455863) has the molecular formula C13H18N2O2S2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[2-(2-methylpropoxy)ethylsulfinyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-[2-(2-methylpropoxy)ethylsulfinyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 106455863 |
| Molecular Formula | C13H18N2O2S2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-[2-(2-methylpropoxy)ethylsulfinyl]-1,3-benzothiazol-6-amine |
| SMILES | CC(C)COCCS(=O)c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C13H18N2O2S2/c1-9(2)8-17-5-6-19(16)13-15-11-4-3-10(14)7-12(11)18-13/h3-4,7,9H,5-6,8,14H2,1-2H3 |
| InChIKey | OKFLKGMKTLKADX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|