C14H10F2N2OS2 — CID 114933049
2-[(2,6-difluorophenyl)methylsulfinyl]-1,3-benzothiazol-6-amine (PubChem CID 114933049) has the molecular formula C14H10F2N2OS2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-[(2,6-difluorophenyl)methylsulfinyl]-1,3-benzothiazol-6-amine.
| Compound Name | 2-[(2,6-difluorophenyl)methylsulfinyl]-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 114933049 |
| Molecular Formula | C14H10F2N2OS2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 2-[(2,6-difluorophenyl)methylsulfinyl]-1,3-benzothiazol-6-amine |
| SMILES | Nc1ccc2nc(S(=O)Cc3c(F)cccc3F)sc2c1 |
| InChI | InChI=1S/C14H10F2N2OS2/c15-10-2-1-3-11(16)9(10)7-21(19)14-18-12-5-4-8(17)6-13(12)20-14/h1-6H,7,17H2 |
| InChIKey | ASFNSFTXEHSSTJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|