C13H9F4NOS — CID 114933054
4-[(2,6-difluorophenyl)methylsulfinyl]-3,5-difluoroaniline (PubChem CID 114933054) has the molecular formula C13H9F4NOS and a molecular weight of 303.28 g/mol. Its IUPAC name is 4-[(2,6-difluorophenyl)methylsulfinyl]-3,5-difluoroaniline.
| Compound Name | 4-[(2,6-difluorophenyl)methylsulfinyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 114933054 |
| Molecular Formula | C13H9F4NOS |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 4-[(2,6-difluorophenyl)methylsulfinyl]-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(S(=O)Cc2c(F)cccc2F)c(F)c1 |
| InChI | InChI=1S/C13H9F4NOS/c14-9-2-1-3-10(15)8(9)6-20(19)13-11(16)4-7(18)5-12(13)17/h1-5H,6,18H2 |
| InChIKey | ADAGSBWHOXFUFQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|