C13H11F2NOS — CID 114935213
3-[(2,6-difluorophenyl)methylsulfinyl]aniline (PubChem CID 114935213) has the molecular formula C13H11F2NOS and a molecular weight of 267.30 g/mol. Its IUPAC name is 3-[(2,6-difluorophenyl)methylsulfinyl]aniline.
| Compound Name | 3-[(2,6-difluorophenyl)methylsulfinyl]aniline |
|---|---|
| PubChem CID | 114935213 |
| Molecular Formula | C13H11F2NOS |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-[(2,6-difluorophenyl)methylsulfinyl]aniline |
| SMILES | Nc1cccc(S(=O)Cc2c(F)cccc2F)c1 |
| InChI | InChI=1S/C13H11F2NOS/c14-12-5-2-6-13(15)11(12)8-18(17)10-4-1-3-9(16)7-10/h1-7H,8,16H2 |
| InChIKey | HGQIGSGJLRZKAG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|