C12H10F2N2OS — CID 61369616
3,5-difluoro-4-(pyridin-3-ylmethylsulfinyl)aniline (PubChem CID 61369616) has the molecular formula C12H10F2N2OS and a molecular weight of 268.29 g/mol. Its IUPAC name is 3,5-difluoro-4-(pyridin-3-ylmethylsulfinyl)aniline.
| Compound Name | 3,5-difluoro-4-(pyridin-3-ylmethylsulfinyl)aniline |
|---|---|
| PubChem CID | 61369616 |
| Molecular Formula | C12H10F2N2OS |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3,5-difluoro-4-(pyridin-3-ylmethylsulfinyl)aniline |
| SMILES | Nc1cc(F)c(S(=O)Cc2cccnc2)c(F)c1 |
| InChI | InChI=1S/C12H10F2N2OS/c13-10-4-9(15)5-11(14)12(10)18(17)7-8-2-1-3-16-6-8/h1-6H,7,15H2 |
| InChIKey | MSUCJDNKKRZRDZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|