C11H8ClF2NOS2 — CID 61369438
4-[(5-chlorothiophen-2-yl)methylsulfinyl]-3,5-difluoroaniline (PubChem CID 61369438) has the molecular formula C11H8ClF2NOS2 and a molecular weight of 307.77 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methylsulfinyl]-3,5-difluoroaniline.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methylsulfinyl]-3,5-difluoroaniline |
|---|---|
| PubChem CID | 61369438 |
| Molecular Formula | C11H8ClF2NOS2 |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methylsulfinyl]-3,5-difluoroaniline |
| SMILES | Nc1cc(F)c(S(=O)Cc2ccc(Cl)s2)c(F)c1 |
| InChI | InChI=1S/C11H8ClF2NOS2/c12-10-2-1-7(17-10)5-18(16)11-8(13)3-6(15)4-9(11)14/h1-4H,5,15H2 |
| InChIKey | VVEKVBAUBBKPOY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|