C14H10N4OS2 — CID 63880653
4-[(6-amino-1,3-benzothiazol-2-yl)sulfinylmethyl]pyridine-2-carbonitrile (PubChem CID 63880653) has the molecular formula C14H10N4OS2 and a molecular weight of 314.40 g/mol. Its IUPAC name is 4-[(6-amino-1,3-benzothiazol-2-yl)sulfinylmethyl]pyridine-2-carbonitrile.
| Compound Name | 4-[(6-amino-1,3-benzothiazol-2-yl)sulfinylmethyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 63880653 |
| Molecular Formula | C14H10N4OS2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 4-[(6-amino-1,3-benzothiazol-2-yl)sulfinylmethyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(CS(=O)c2nc3ccc(N)cc3s2)ccn1 |
| InChI | InChI=1S/C14H10N4OS2/c15-7-11-5-9(3-4-17-11)8-21(19)14-18-12-2-1-10(16)6-13(12)20-14/h1-6H,8,16H2 |
| InChIKey | XTODCWHZVYOIHS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|