C13H18N2OS2 — CID 61367485
2-hexylsulfinyl-1,3-benzothiazol-6-amine (PubChem CID 61367485) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-hexylsulfinyl-1,3-benzothiazol-6-amine.
| Compound Name | 2-hexylsulfinyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 61367485 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-hexylsulfinyl-1,3-benzothiazol-6-amine |
| SMILES | CCCCCCS(=O)c1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C13H18N2OS2/c1-2-3-4-5-8-18(16)13-15-11-7-6-10(14)9-12(11)17-13/h6-7,9H,2-5,8,14H2,1H3 |
| InChIKey | YVIYZWXNADQEQP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|