About azane;1,2-di(propan-2-yl)naphthalene
azane;1,2-di(propan-2-yl)naphthalene (PubChem CID 172719874) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is azane;1,2-di(propan-2-yl)naphthalene.
Molecular Properties
| Compound Name | azane;1,2-di(propan-2-yl)naphthalene |
| PubChem CID | 172719874 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | azane;1,2-di(propan-2-yl)naphthalene |
| SMILES | CC(C)c1ccc2ccccc2c1C(C)C.N |
| InChI | InChI=1S/C16H20.H3N/c1-11(2)14-10-9-13-7-5-6-8-15(13)16(14)12(3)4;/h5-12H,1-4H3;1H3 |
| InChIKey | GJAAHLVTTPASQY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1,2-di(propan-2-yl)naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1,2-di(propan-2-yl)naphthalene?
The IUPAC name of azane;1,2-di(propan-2-yl)naphthalene (CID 172719874) is azane;1,2-di(propan-2-yl)naphthalene.
What is the SMILES notation for azane;1,2-di(propan-2-yl)naphthalene?
The canonical SMILES for azane;1,2-di(propan-2-yl)naphthalene is CC(C)c1ccc2ccccc2c1C(C)C.N.
What is the InChIKey of azane;1,2-di(propan-2-yl)naphthalene?
The InChIKey is GJAAHLVTTPASQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20.H3N/c1-11(2)14-10-9-13-7-5-6-8-15(13)16(14)12(3)4;/h5-12H,1-4H3;1H3.
What are the key properties of azane;1,2-di(propan-2-yl)naphthalene?
azane;1,2-di(propan-2-yl)naphthalene has a molecular weight of 229.37 g/mol, XLogP of 5.25, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1,2-di(propan-2-yl)naphthalene is sourced from PubChem (CID 172719874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).