C20H28 — CID 142283671
6-methyl-1,2,7-tri(propan-2-yl)naphthalene (PubChem CID 142283671) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 6-methyl-1,2,7-tri(propan-2-yl)naphthalene.
| Compound Name | 6-methyl-1,2,7-tri(propan-2-yl)naphthalene |
|---|---|
| PubChem CID | 142283671 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 6-methyl-1,2,7-tri(propan-2-yl)naphthalene |
| SMILES | Cc1cc2ccc(C(C)C)c(C(C)C)c2cc1C(C)C |
| InChI | InChI=1S/C20H28/c1-12(2)17-9-8-16-10-15(7)18(13(3)4)11-19(16)20(17)14(5)6/h8-14H,1-7H3 |
| InChIKey | ACTJBYPEQKYIJR-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |