C32H46 — CID 177088440
2,3,6,7,9,10-hexa(propan-2-yl)phenanthrene (PubChem CID 177088440) has the molecular formula C32H46 and a molecular weight of 430.72 g/mol. Its IUPAC name is 2,3,6,7,9,10-hexa(propan-2-yl)phenanthrene.
| Compound Name | 2,3,6,7,9,10-hexa(propan-2-yl)phenanthrene |
|---|---|
| PubChem CID | 177088440 |
| Molecular Formula | C32H46 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.36 |
| IUPAC Name | 2,3,6,7,9,10-hexa(propan-2-yl)phenanthrene |
| SMILES | CC(C)c1cc2c(C(C)C)c(C(C)C)c3cc(C(C)C)c(C(C)C)cc3c2cc1C(C)C |
| InChI | InChI=1S/C32H46/c1-17(2)23-13-27-28-14-24(18(3)4)26(20(7)8)16-30(28)32(22(11)12)31(21(9)10)29(27)15-25(23)19(5)6/h13-22H,1-12H3 |
| InChIKey | MIWPDGYLZRYZSV-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|