C78H102 — CID 165025507
bis(1,2,5,6-tetra(propan-2-yl)anthracene);1,2,7,8-tetra(propan-2-yl)anthracene (PubChem CID 165025507) has the molecular formula C78H102 and a molecular weight of 1039.67 g/mol. Its IUPAC name is bis(1,2,5,6-tetra(propan-2-yl)anthracene);1,2,7,8-tetra(propan-2-yl)anthracene.
| Compound Name | bis(1,2,5,6-tetra(propan-2-yl)anthracene);1,2,7,8-tetra(propan-2-yl)anthracene |
|---|---|
| PubChem CID | 165025507 |
| Molecular Formula | C78H102 |
| Molecular Weight | 1039.67 g/mol |
| Exact Mass | 1038.80 |
| IUPAC Name | bis(1,2,5,6-tetra(propan-2-yl)anthracene);1,2,7,8-tetra(propan-2-yl)anthracene |
| SMILES | CC(C)c1ccc2cc3c(C(C)C)c(C(C)C)ccc3cc2c1C(C)C.CC(C)c1ccc2cc3c(C(C)C)c(C(C)C)ccc3cc2c1C(C)C.CC(C)c1ccc2cc3ccc(C(C)C)c(C(C)C)c3cc2c1C(C)C |
| InChI | InChI=1S/3C26H34/c2*1-15(2)21-11-9-19-14-24-20(13-23(19)25(21)17(5)6)10-12-22(16(3)4)26(24)18(7)8;1-15(2)21-11-9-19-13-20-10-12-22(16(3)4)26(18(7)8)24(20)14-23(19)25(21)17(5)6/h3*9-18H,1-8H3 |
| InChIKey | LVASDZNBOLDSJO-UHFFFAOYSA-N |
| XLogP | 25.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.67 |
| LogP ≤ 5 | 25.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|