C16H24O4 — CID 19002409
1,2-di(propan-2-yl)naphthalene;hydrogen peroxide (PubChem CID 19002409) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 1,2-di(propan-2-yl)naphthalene;hydrogen peroxide.
| Compound Name | 1,2-di(propan-2-yl)naphthalene;hydrogen peroxide |
|---|---|
| PubChem CID | 19002409 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1,2-di(propan-2-yl)naphthalene;hydrogen peroxide |
| SMILES | CC(C)c1ccc2ccccc2c1C(C)C.OO.OO |
| InChI | InChI=1S/C16H20.2H2O2/c1-11(2)14-10-9-13-7-5-6-8-15(13)16(14)12(3)4;2*1-2/h5-12H,1-4H3;2*1-2H |
| InChIKey | WRJDXIDFGOPHNQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|